C23H30O8S — CID 88605760
2-[4-[2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethanol;3-hydroxy-4-oxo-4-sulfanylbutanoic acid (PubChem CID 88605760) has the molecular formula C23H30O8S and a molecular weight of 466.55 g/mol. Its IUPAC name is 2-[4-[2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethanol;3-hydroxy-4-oxo-4-sulfanylbutanoic acid.
| Compound Name | 2-[4-[2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethanol;3-hydroxy-4-oxo-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 88605760 |
| Molecular Formula | C23H30O8S |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-[4-[2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethanol;3-hydroxy-4-oxo-4-sulfanylbutanoic acid |
| SMILES | CC(C)(c1ccc(OCCO)cc1)c1ccc(OCCO)cc1.O=C(O)CC(O)C(=O)S |
| InChI | InChI=1S/C19H24O4.C4H6O4S/c1-19(2,15-3-7-17(8-4-15)22-13-11-20)16-5-9-18(10-6-16)23-14-12-21;5-2(4(8)9)1-3(6)7/h3-10,20-21H,11-14H2,1-2H3;2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | WDZXTDUMTACDGK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|