C29H32O8 — CID 129196166
5-hydroxy-6-[4-[2-[4-(2-hydroxy-5-methyl-3,4-dioxohex-5-enoxy)phenyl]propan-2-yl]phenoxy]-2-methylhex-1-ene-3,4-dione (PubChem CID 129196166) has the molecular formula C29H32O8 and a molecular weight of 508.57 g/mol. Its IUPAC name is 5-hydroxy-6-[4-[2-[4-(2-hydroxy-5-methyl-3,4-dioxohex-5-enoxy)phenyl]propan-2-yl]phenoxy]-2-methylhex-1-ene-3,4-dione.
| Compound Name | 5-hydroxy-6-[4-[2-[4-(2-hydroxy-5-methyl-3,4-dioxohex-5-enoxy)phenyl]propan-2-yl]phenoxy]-2-methylhex-1-ene-3,4-dione |
|---|---|
| PubChem CID | 129196166 |
| Molecular Formula | C29H32O8 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 5-hydroxy-6-[4-[2-[4-(2-hydroxy-5-methyl-3,4-dioxohex-5-enoxy)phenyl]propan-2-yl]phenoxy]-2-methylhex-1-ene-3,4-dione |
| SMILES | C=C(C)C(=O)C(=O)C(O)COc1ccc(C(C)(C)c2ccc(OCC(O)C(=O)C(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C29H32O8/c1-17(2)25(32)27(34)23(30)15-36-21-11-7-19(8-12-21)29(5,6)20-9-13-22(14-10-20)37-16-24(31)28(35)26(33)18(3)4/h7-14,23-24,30-31H,1,3,15-16H2,2,4-6H3 |
| InChIKey | AYXJUNWZKOFUBG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|