C16H32N2O6Si — CID 175043717
5-[[ethyl-(2-methyl-3-trimethoxysilylpropyl)carbamoyl]amino]-2-methylpent-2-enoic acid (PubChem CID 175043717) has the molecular formula C16H32N2O6Si and a molecular weight of 376.53 g/mol. Its IUPAC name is 5-[[ethyl-(2-methyl-3-trimethoxysilylpropyl)carbamoyl]amino]-2-methylpent-2-enoic acid.
| Compound Name | 5-[[ethyl-(2-methyl-3-trimethoxysilylpropyl)carbamoyl]amino]-2-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 175043717 |
| Molecular Formula | C16H32N2O6Si |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 5-[[ethyl-(2-methyl-3-trimethoxysilylpropyl)carbamoyl]amino]-2-methylpent-2-enoic acid |
| SMILES | CCN(CC(C)C[Si](OC)(OC)OC)C(=O)NCCC=C(C)C(=O)O |
| InChI | InChI=1S/C16H32N2O6Si/c1-7-18(11-13(2)12-25(22-4,23-5)24-6)16(21)17-10-8-9-14(3)15(19)20/h9,13H,7-8,10-12H2,1-6H3,(H,17,21)(H,19,20) |
| InChIKey | GNDLRSJCXRQFBH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|