About phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine
phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine (PubChem CID 175044718) has the molecular formula C13H15N2P
and a molecular weight of 230.25 g/mol. Its IUPAC name is phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine |
| PubChem CID | 175044718 |
| Molecular Formula | C13H15N2P |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine |
| SMILES | C=CCc1cccnc1-c1ccccn1.P |
| InChI | InChI=1S/C13H12N2.H3P/c1-2-6-11-7-5-10-15-13(11)12-8-3-4-9-14-12;/h2-5,7-10H,1,6H2;1H3 |
| InChIKey | HDRIVBYOLCSRQB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine?
The IUPAC name of phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine (CID 175044718) is phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine.
What is the SMILES notation for phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine?
The canonical SMILES for phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine is C=CCc1cccnc1-c1ccccn1.P.
What is the InChIKey of phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine?
The InChIKey is HDRIVBYOLCSRQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2.H3P/c1-2-6-11-7-5-10-15-13(11)12-8-3-4-9-14-12;/h2-5,7-10H,1,6H2;1H3.
What are the key properties of phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine?
phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine has a molecular weight of 230.25 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phosphane;3-prop-2-enyl-2-pyridin-2-ylpyridine is sourced from PubChem (CID 175044718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).