About benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid
benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid (PubChem CID 175045349) has the molecular formula C17H14O5
and a molecular weight of 298.29 g/mol. Its IUPAC name is benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid.
Molecular Properties
| Compound Name | benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid |
| PubChem CID | 175045349 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid |
| SMILES | C=CC(=O)c1ccc(C(=O)O)c(O)c1.O=Cc1ccccc1 |
| InChI | InChI=1S/C10H8O4.C7H6O/c1-2-8(11)6-3-4-7(10(13)14)9(12)5-6;8-6-7-4-2-1-3-5-7/h2-5,12H,1H2,(H,13,14);1-6H |
| InChIKey | YRZMHVCWPSQBEN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid?
The IUPAC name of benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid (CID 175045349) is benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid.
What is the SMILES notation for benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid?
The canonical SMILES for benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid is C=CC(=O)c1ccc(C(=O)O)c(O)c1.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid?
The InChIKey is YRZMHVCWPSQBEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4.C7H6O/c1-2-8(11)6-3-4-7(10(13)14)9(12)5-6;8-6-7-4-2-1-3-5-7/h2-5,12H,1H2,(H,13,14);1-6H.
What are the key properties of benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid?
benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid has a molecular weight of 298.29 g/mol, XLogP of 2.96, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;2-hydroxy-4-prop-2-enoylbenzoic acid is sourced from PubChem (CID 175045349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).