About N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride
N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride (PubChem CID 175045491) has the molecular formula C19H49Cl3N4O
and a molecular weight of 455.99 g/mol. Its IUPAC name is N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride.
Molecular Properties
| Compound Name | N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride |
| PubChem CID | 175045491 |
| Molecular Formula | C19H49Cl3N4O |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride |
| SMILES | CCCCCCCCCCCCCCCC(=O)NC(N)CC.Cl.Cl.Cl.N.N |
| InChI | InChI=1S/C19H40N2O.3ClH.2H3N/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)21-18(20)4-2;;;;;/h18H,3-17,20H2,1-2H3,(H,21,22);3*1H;2*1H3 |
| InChIKey | RGTYHYKCDKBVCQ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride?
The IUPAC name of N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride (CID 175045491) is N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride.
What is the SMILES notation for N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride?
The canonical SMILES for N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride is CCCCCCCCCCCCCCCC(=O)NC(N)CC.Cl.Cl.Cl.N.N.
What is the InChIKey of N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride?
The InChIKey is RGTYHYKCDKBVCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40N2O.3ClH.2H3N/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)21-18(20)4-2;;;;;/h18H,3-17,20H2,1-2H3,(H,21,22);3*1H;2*1H3.
What are the key properties of N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride?
N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride has a molecular weight of 455.99 g/mol, XLogP of 6.87, 16 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminopropyl)hexadecanamide;azane;trihydrochloride is sourced from PubChem (CID 175045491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).