C9H21N3O — CID 164724851
N-(1,2-diaminoethyl)heptanamide (PubChem CID 164724851) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is N-(1,2-diaminoethyl)heptanamide.
| Compound Name | N-(1,2-diaminoethyl)heptanamide |
|---|---|
| PubChem CID | 164724851 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | N-(1,2-diaminoethyl)heptanamide |
| SMILES | CCCCCCC(=O)NC(N)CN |
| InChI | InChI=1S/C9H21N3O/c1-2-3-4-5-6-9(13)12-8(11)7-10/h8H,2-7,10-11H2,1H3,(H,12,13) |
| InChIKey | PMYZUPGHMIIUAT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|