C18H15Si — CID 175048024
CID 175048024 (PubChem CID 175048024) has the molecular formula C18H15Si and a molecular weight of 259.40 g/mol.
| Compound Name | CID 175048024 |
|---|---|
| PubChem CID | 175048024 |
| Molecular Formula | C18H15Si |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | — |
| SMILES | [Si]C1C=Cc2c1cc1c(c2-c2ccccc2)CCC1 |
| InChI | InChI=1S/C18H15Si/c19-17-10-9-15-16(17)11-13-7-4-8-14(13)18(15)12-5-2-1-3-6-12/h1-3,5-6,9-11,17H,4,7-8H2 |
| InChIKey | VQLWPDUUMATBPA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|