C36H30Zr — CID 175031068
bis(8-phenyl-1,2,3,5-tetrahydro-s-indacen-5-ide);zirconium(2+) (PubChem CID 175031068) has the molecular formula C36H30Zr and a molecular weight of 553.86 g/mol. Its IUPAC name is bis(8-phenyl-1,2,3,5-tetrahydro-s-indacen-5-ide);zirconium(2+).
| Compound Name | bis(8-phenyl-1,2,3,5-tetrahydro-s-indacen-5-ide);zirconium(2+) |
|---|---|
| PubChem CID | 175031068 |
| Molecular Formula | C36H30Zr |
| Molecular Weight | 553.86 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | bis(8-phenyl-1,2,3,5-tetrahydro-s-indacen-5-ide);zirconium(2+) |
| SMILES | [Zr+2].c1ccc(-c2c3c(cc4[cH-]ccc24)CCC3)cc1.c1ccc(-c2c3c(cc4[cH-]ccc24)CCC3)cc1 |
| InChI | InChI=1S/2C18H15.Zr/c2*1-2-6-13(7-3-1)18-16-10-4-8-14(16)12-15-9-5-11-17(15)18;/h2*1-4,6-8,10,12H,5,9,11H2;/q2*-1;+2 |
| InChIKey | MTDSPVARSANSOG-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.86 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|