C27H28Zr — CID 175031329
2-butylcyclopenta-1,3-diene;8-phenyl-1,2,3,5-tetrahydro-s-indacen-5-ide;zirconium(2+) (PubChem CID 175031329) has the molecular formula C27H28Zr and a molecular weight of 443.75 g/mol. Its IUPAC name is 2-butylcyclopenta-1,3-diene;8-phenyl-1,2,3,5-tetrahydro-s-indacen-5-ide;zirconium(2+).
| Compound Name | 2-butylcyclopenta-1,3-diene;8-phenyl-1,2,3,5-tetrahydro-s-indacen-5-ide;zirconium(2+) |
|---|---|
| PubChem CID | 175031329 |
| Molecular Formula | C27H28Zr |
| Molecular Weight | 443.75 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-butylcyclopenta-1,3-diene;8-phenyl-1,2,3,5-tetrahydro-s-indacen-5-ide;zirconium(2+) |
| SMILES | CCCCC1=CC[C-]=C1.[Zr+2].c1ccc(-c2c3c(cc4[cH-]ccc24)CCC3)cc1 |
| InChI | InChI=1S/C18H15.C9H13.Zr/c1-2-6-13(7-3-1)18-16-10-4-8-14(16)12-15-9-5-11-17(15)18;1-2-3-6-9-7-4-5-8-9;/h1-4,6-8,10,12H,5,9,11H2;7-8H,2-4,6H2,1H3;/q2*-1;+2 |
| InChIKey | ZIDBIGUYFSXYJZ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.75 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|