C8H10F2O3 — CID 175048414
4-(2,4-difluorooxetan-3-yl)oxypent-1-en-3-one (PubChem CID 175048414) has the molecular formula C8H10F2O3 and a molecular weight of 192.16 g/mol. Its IUPAC name is 4-(2,4-difluorooxetan-3-yl)oxypent-1-en-3-one.
| Compound Name | 4-(2,4-difluorooxetan-3-yl)oxypent-1-en-3-one |
|---|---|
| PubChem CID | 175048414 |
| Molecular Formula | C8H10F2O3 |
| Molecular Weight | 192.16 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 4-(2,4-difluorooxetan-3-yl)oxypent-1-en-3-one |
| SMILES | C=CC(=O)C(C)OC1C(F)OC1F |
| InChI | InChI=1S/C8H10F2O3/c1-3-5(11)4(2)12-6-7(9)13-8(6)10/h3-4,6-8H,1H2,2H3 |
| InChIKey | OSSVFBVRFXTLRS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|