C5H8ClNO2S — CID 175050255
2-methyl-4-oxo-1,2-thiazolidine-3-carbaldehyde;hydrochloride (PubChem CID 175050255) has the molecular formula C5H8ClNO2S and a molecular weight of 181.64 g/mol. Its IUPAC name is 2-methyl-4-oxo-1,2-thiazolidine-3-carbaldehyde;hydrochloride.
| Compound Name | 2-methyl-4-oxo-1,2-thiazolidine-3-carbaldehyde;hydrochloride |
|---|---|
| PubChem CID | 175050255 |
| Molecular Formula | C5H8ClNO2S |
| Molecular Weight | 181.64 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 2-methyl-4-oxo-1,2-thiazolidine-3-carbaldehyde;hydrochloride |
| SMILES | CN1SCC(=O)C1C=O.Cl |
| InChI | InChI=1S/C5H7NO2S.ClH/c1-6-4(2-7)5(8)3-9-6;/h2,4H,3H2,1H3;1H |
| InChIKey | LGMRZMUCNDPOKC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.64 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|