C28H29FN4O3 — CID 175052415
N-[4-[4-(4-cyanophenyl)piperazin-1-yl]phenyl]-3-[2-(2-fluoroethoxy)ethoxy]benzamide (PubChem CID 175052415) has the molecular formula C28H29FN4O3 and a molecular weight of 488.56 g/mol. Its IUPAC name is N-[4-[4-(4-cyanophenyl)piperazin-1-yl]phenyl]-3-[2-(2-fluoroethoxy)ethoxy]benzamide.
| Compound Name | N-[4-[4-(4-cyanophenyl)piperazin-1-yl]phenyl]-3-[2-(2-fluoroethoxy)ethoxy]benzamide |
|---|---|
| PubChem CID | 175052415 |
| Molecular Formula | C28H29FN4O3 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | N-[4-[4-(4-cyanophenyl)piperazin-1-yl]phenyl]-3-[2-(2-fluoroethoxy)ethoxy]benzamide |
| SMILES | N#Cc1ccc(N2CCN(c3ccc(NC(=O)c4cccc(OCCOCCF)c4)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H29FN4O3/c29-12-17-35-18-19-36-27-3-1-2-23(20-27)28(34)31-24-6-10-26(11-7-24)33-15-13-32(14-16-33)25-8-4-22(21-30)5-9-25/h1-11,20H,12-19H2,(H,31,34) |
| InChIKey | ADEJZLDOCPQAOM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|