C28H27N5O3 — CID 142608108
N-[4-[4-(5-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-4-(2-prop-2-ynoxyethoxy)benzamide (PubChem CID 142608108) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is N-[4-[4-(5-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-4-(2-prop-2-ynoxyethoxy)benzamide.
| Compound Name | N-[4-[4-(5-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-4-(2-prop-2-ynoxyethoxy)benzamide |
|---|---|
| PubChem CID | 142608108 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-[4-[4-(5-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-4-(2-prop-2-ynoxyethoxy)benzamide |
| SMILES | C#CCOCCOc1ccc(C(=O)Nc2ccc(N3CCN(c4ccc(C#N)cn4)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H27N5O3/c1-2-17-35-18-19-36-26-10-4-23(5-11-26)28(34)31-24-6-8-25(9-7-24)32-13-15-33(16-14-32)27-12-3-22(20-29)21-30-27/h1,3-12,21H,13-19H2,(H,31,34) |
| InChIKey | IMGSDRQQWFBESV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|