C20H32O6 — CID 175055510
5,11-dimethylpentadeca-3,12-diene-1,6,15-tricarboxylic acid (PubChem CID 175055510) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 5,11-dimethylpentadeca-3,12-diene-1,6,15-tricarboxylic acid.
| Compound Name | 5,11-dimethylpentadeca-3,12-diene-1,6,15-tricarboxylic acid |
|---|---|
| PubChem CID | 175055510 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 5,11-dimethylpentadeca-3,12-diene-1,6,15-tricarboxylic acid |
| SMILES | CC(C=CCCC(=O)O)CCCCC(C(=O)O)C(C)C=CCCC(=O)O |
| InChI | InChI=1S/C20H32O6/c1-15(10-4-7-13-18(21)22)9-3-6-12-17(20(25)26)16(2)11-5-8-14-19(23)24/h4-5,10-11,15-17H,3,6-9,12-14H2,1-2H3,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | VDWKXLOBLDHFDP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|