C23H36O3 — CID 91062664
7-hydroxy-14-methyldocosa-4,8,10,12,19-pentaenoic acid (PubChem CID 91062664) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is 7-hydroxy-14-methyldocosa-4,8,10,12,19-pentaenoic acid.
| Compound Name | 7-hydroxy-14-methyldocosa-4,8,10,12,19-pentaenoic acid |
|---|---|
| PubChem CID | 91062664 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 7-hydroxy-14-methyldocosa-4,8,10,12,19-pentaenoic acid |
| SMILES | CCC=CCCCCC(C)C=CC=CC=CC(O)CC=CCCC(=O)O |
| InChI | InChI=1S/C23H36O3/c1-3-4-5-6-7-11-16-21(2)17-12-8-9-13-18-22(24)19-14-10-15-20-23(25)26/h4-5,8-10,12-14,17-18,21-22,24H,3,6-7,11,15-16,19-20H2,1-2H3,(H,25,26) |
| InChIKey | OWJAOLBWJPTRCP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|