C28H41NO2 — CID 175056880
(1R,2S,7S,8S,9S,11R,12S,15R,17R)-15-hydroxy-9,15-dimethyl-N-phenyltetracyclo[9.8.0.02,8.012,17]nonadecane-7-carboxamide (PubChem CID 175056880) has the molecular formula C28H41NO2 and a molecular weight of 423.64 g/mol. Its IUPAC name is (1R,2S,7S,8S,9S,11R,12S,15R,17R)-15-hydroxy-9,15-dimethyl-N-phenyltetracyclo[9.8.0.02,8.012,17]nonadecane-7-carboxamide.
| Compound Name | (1R,2S,7S,8S,9S,11R,12S,15R,17R)-15-hydroxy-9,15-dimethyl-N-phenyltetracyclo[9.8.0.02,8.012,17]nonadecane-7-carboxamide |
|---|---|
| PubChem CID | 175056880 |
| Molecular Formula | C28H41NO2 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | (1R,2S,7S,8S,9S,11R,12S,15R,17R)-15-hydroxy-9,15-dimethyl-N-phenyltetracyclo[9.8.0.02,8.012,17]nonadecane-7-carboxamide |
| SMILES | C[C@H]1C[C@H]2[C@@H](CC[C@@H]3C[C@](C)(O)CC[C@@H]32)[C@@H]2CCCC[C@H](C(=O)Nc3ccccc3)[C@H]21 |
| InChI | InChI=1S/C28H41NO2/c1-18-16-25-21-14-15-28(2,31)17-19(21)12-13-22(25)23-10-6-7-11-24(26(18)23)27(30)29-20-8-4-3-5-9-20/h3-5,8-9,18-19,21-26,31H,6-7,10-17H2,1-2H3,(H,29,30)/t18-,19+,21-,22-,23-,24-,25+,26-,28+/m0/s1 |
| InChIKey | XBUZRDZEMGBKKH-GGQKWWPOSA-N |
| XLogP | 6.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |