C15H19NO3 — CID 10706534
(1S,2S,4R,5S,6R)-5,6-dihydroxy-N-phenylbicyclo[2.2.2]octane-2-carboxamide (PubChem CID 10706534) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (1S,2S,4R,5S,6R)-5,6-dihydroxy-N-phenylbicyclo[2.2.2]octane-2-carboxamide.
| Compound Name | (1S,2S,4R,5S,6R)-5,6-dihydroxy-N-phenylbicyclo[2.2.2]octane-2-carboxamide |
|---|---|
| PubChem CID | 10706534 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (1S,2S,4R,5S,6R)-5,6-dihydroxy-N-phenylbicyclo[2.2.2]octane-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@H]1C[C@H]2CC[C@@H]1[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C15H19NO3/c17-13-9-6-7-11(14(13)18)12(8-9)15(19)16-10-4-2-1-3-5-10/h1-5,9,11-14,17-18H,6-8H2,(H,16,19)/t9-,11+,12+,13+,14-/m1/s1 |
| InChIKey | IZYAFVFPOOCHPT-KYLSFTOHSA-N |
| XLogP | 1.39 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |