C19H35N — CID 175059310
1,2,3-tripropyladamantan-2-amine (PubChem CID 175059310) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is 1,2,3-tripropyladamantan-2-amine.
| Compound Name | 1,2,3-tripropyladamantan-2-amine |
|---|---|
| PubChem CID | 175059310 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | 1,2,3-tripropyladamantan-2-amine |
| SMILES | CCCC12CC3CC(C1)CC(CCC)(C3)C2(N)CCC |
| InChI | InChI=1S/C19H35N/c1-4-7-17-11-15-10-16(12-17)14-18(13-15,8-5-2)19(17,20)9-6-3/h15-16H,4-14,20H2,1-3H3 |
| InChIKey | VPDYFHGSPMJVPU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |