About 3-(oxiran-2-yl)propanoyl chloride
3-(oxiran-2-yl)propanoyl chloride (PubChem CID 175059672) has the molecular formula C5H7ClO2
and a molecular weight of 134.56 g/mol. Its IUPAC name is 3-(oxiran-2-yl)propanoyl chloride.
Molecular Properties
| Compound Name | 3-(oxiran-2-yl)propanoyl chloride |
| PubChem CID | 175059672 |
| Molecular Formula | C5H7ClO2 |
| Molecular Weight | 134.56 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | 3-(oxiran-2-yl)propanoyl chloride |
| SMILES | O=C(Cl)CCC1CO1 |
| InChI | InChI=1S/C5H7ClO2/c6-5(7)2-1-4-3-8-4/h4H,1-3H2 |
| InChIKey | RBOPRSVWKUWBGV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.56 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(oxiran-2-yl)propanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxiran-2-yl)propanoyl chloride?
The IUPAC name of 3-(oxiran-2-yl)propanoyl chloride (CID 175059672) is 3-(oxiran-2-yl)propanoyl chloride.
What is the SMILES notation for 3-(oxiran-2-yl)propanoyl chloride?
The canonical SMILES for 3-(oxiran-2-yl)propanoyl chloride is O=C(Cl)CCC1CO1.
What is the InChIKey of 3-(oxiran-2-yl)propanoyl chloride?
The InChIKey is RBOPRSVWKUWBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClO2/c6-5(7)2-1-4-3-8-4/h4H,1-3H2.
What are the key properties of 3-(oxiran-2-yl)propanoyl chloride?
3-(oxiran-2-yl)propanoyl chloride has a molecular weight of 134.56 g/mol, XLogP of 0.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxiran-2-yl)propanoyl chloride is sourced from PubChem (CID 175059672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).