C13H18N2OS2 — CID 175060036
[1-(1,3-benzothiazol-2-yl)ethylamino]-tert-butyl-oxidosulfanium (PubChem CID 175060036) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is [1-(1,3-benzothiazol-2-yl)ethylamino]-tert-butyl-oxidosulfanium.
| Compound Name | [1-(1,3-benzothiazol-2-yl)ethylamino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 175060036 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | [1-(1,3-benzothiazol-2-yl)ethylamino]-tert-butyl-oxidosulfanium |
| SMILES | CC(N[S+]([O-])C(C)(C)C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H18N2OS2/c1-9(15-18(16)13(2,3)4)12-14-10-7-5-6-8-11(10)17-12/h5-9,15H,1-4H3 |
| InChIKey | NXQYGEWMOGOAFF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|