About sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride
sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride (PubChem CID 175060569) has the molecular formula C10H12N3NaO5
and a molecular weight of 277.21 g/mol. Its IUPAC name is sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride.
Molecular Properties
| Compound Name | sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride |
| PubChem CID | 175060569 |
| Molecular Formula | C10H12N3NaO5 |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride |
| SMILES | NC(=O)NOC(=O)CCc1ccc([N+](=O)[O-])cc1.[H-].[Na+] |
| InChI | InChI=1S/C10H11N3O5.Na.H/c11-10(15)12-18-9(14)6-3-7-1-4-8(5-2-7)13(16)17;;/h1-2,4-5H,3,6H2,(H3,11,12,15);;/q;+1;-1 |
| InChIKey | WZTDTURGFMEZOP-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride?
The IUPAC name of sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride (CID 175060569) is sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride.
What is the SMILES notation for sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride?
The canonical SMILES for sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride is NC(=O)NOC(=O)CCc1ccc([N+](=O)[O-])cc1.[H-].[Na+].
What is the InChIKey of sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride?
The InChIKey is WZTDTURGFMEZOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O5.Na.H/c11-10(15)12-18-9(14)6-3-7-1-4-8(5-2-7)13(16)17;;/h1-2,4-5H,3,6H2,(H3,11,12,15);;/q;+1;-1.
What are the key properties of sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride?
sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride has a molecular weight of 277.21 g/mol, XLogP of -2.23, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(carbamoylamino) 3-(4-nitrophenyl)propanoate;hydride is sourced from PubChem (CID 175060569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).