C18H28N2O5 — CID 143322097
acetamide;cyclopentyl 3-(4-nitrophenyl)propanoate;ethane (PubChem CID 143322097) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is acetamide;cyclopentyl 3-(4-nitrophenyl)propanoate;ethane.
| Compound Name | acetamide;cyclopentyl 3-(4-nitrophenyl)propanoate;ethane |
|---|---|
| PubChem CID | 143322097 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | acetamide;cyclopentyl 3-(4-nitrophenyl)propanoate;ethane |
| SMILES | CC.CC(N)=O.O=C(CCc1ccc([N+](=O)[O-])cc1)OC1CCCC1 |
| InChI | InChI=1S/C14H17NO4.C2H5NO.C2H6/c16-14(19-13-3-1-2-4-13)10-7-11-5-8-12(9-6-11)15(17)18;1-2(3)4;1-2/h5-6,8-9,13H,1-4,7,10H2;1H3,(H2,3,4);1-2H3 |
| InChIKey | NRLHICXFKSFINH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|