C25H31NO2S — CID 175062084
(8S,9S,10R,13S,14S)-1-(4-aminophenyl)sulfanyl-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 175062084) has the molecular formula C25H31NO2S and a molecular weight of 409.60 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-1-(4-aminophenyl)sulfanyl-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,9S,10R,13S,14S)-1-(4-aminophenyl)sulfanyl-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 175062084 |
| Molecular Formula | C25H31NO2S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (8S,9S,10R,13S,14S)-1-(4-aminophenyl)sulfanyl-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC(Sc5ccc(N)cc5)[C@@]43C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C25H31NO2S/c1-24-12-11-21-19(20(24)9-10-22(24)28)8-3-15-13-17(27)14-23(25(15,21)2)29-18-6-4-16(26)5-7-18/h4-7,13,19-21,23H,3,8-12,14,26H2,1-2H3/t19-,20-,21-,23?,24-,25-/m0/s1 |
| InChIKey | YWPBNKIGCVYHQR-OPOFVPGRSA-N |
| XLogP | 5.44 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|