C15H24N2O6S — CID 175063433
[5-hydroxy-2-methyl-6-[3-(methylsulfamoyl)phenoxy]hexan-2-yl] carbamate (PubChem CID 175063433) has the molecular formula C15H24N2O6S and a molecular weight of 360.43 g/mol. Its IUPAC name is [5-hydroxy-2-methyl-6-[3-(methylsulfamoyl)phenoxy]hexan-2-yl] carbamate.
| Compound Name | [5-hydroxy-2-methyl-6-[3-(methylsulfamoyl)phenoxy]hexan-2-yl] carbamate |
|---|---|
| PubChem CID | 175063433 |
| Molecular Formula | C15H24N2O6S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [5-hydroxy-2-methyl-6-[3-(methylsulfamoyl)phenoxy]hexan-2-yl] carbamate |
| SMILES | CNS(=O)(=O)c1cccc(OCC(O)CCC(C)(C)OC(N)=O)c1 |
| InChI | InChI=1S/C15H24N2O6S/c1-15(2,23-14(16)19)8-7-11(18)10-22-12-5-4-6-13(9-12)24(20,21)17-3/h4-6,9,11,17-18H,7-8,10H2,1-3H3,(H2,16,19) |
| InChIKey | XJKBCNLRWGGRDL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |