C24H18N4O4 — CID 175063620
2-[(E)-1,3-diphenyl-2-(1,2,4-triazol-1-yl)prop-2-enyl]-3-nitrobenzoic acid (PubChem CID 175063620) has the molecular formula C24H18N4O4 and a molecular weight of 426.43 g/mol. Its IUPAC name is 2-[(E)-1,3-diphenyl-2-(1,2,4-triazol-1-yl)prop-2-enyl]-3-nitrobenzoic acid.
| Compound Name | 2-[(E)-1,3-diphenyl-2-(1,2,4-triazol-1-yl)prop-2-enyl]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 175063620 |
| Molecular Formula | C24H18N4O4 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-[(E)-1,3-diphenyl-2-(1,2,4-triazol-1-yl)prop-2-enyl]-3-nitrobenzoic acid |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1C(/C(=C\c1ccccc1)n1cncn1)c1ccccc1 |
| InChI | InChI=1S/C24H18N4O4/c29-24(30)19-12-7-13-20(28(31)32)23(19)22(18-10-5-2-6-11-18)21(27-16-25-15-26-27)14-17-8-3-1-4-9-17/h1-16,22H,(H,29,30)/b21-14+ |
| InChIKey | PJZJNFJXWHIBSO-KGENOOAVSA-N |
| XLogP | 4.71 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|