C11H13CuN3O6 — CID 175063962
copper;6-pentoxycarbonyltriazine-4,5-dicarboxylic acid (PubChem CID 175063962) has the molecular formula C11H13CuN3O6 and a molecular weight of 346.79 g/mol. Its IUPAC name is copper;6-pentoxycarbonyltriazine-4,5-dicarboxylic acid.
| Compound Name | copper;6-pentoxycarbonyltriazine-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 175063962 |
| Molecular Formula | C11H13CuN3O6 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | copper;6-pentoxycarbonyltriazine-4,5-dicarboxylic acid |
| SMILES | CCCCCOC(=O)c1nnnc(C(=O)O)c1C(=O)O.[Cu] |
| InChI | InChI=1S/C11H13N3O6.Cu/c1-2-3-4-5-20-11(19)8-6(9(15)16)7(10(17)18)12-14-13-8;/h2-5H2,1H3,(H,15,16)(H,17,18); |
| InChIKey | QWOCLDCZGNUWTH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 139.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|