C27H17Li — CID 175065646
lithium 1-cyclopenta-1,4-dien-1-ylpentaphene (PubChem CID 175065646) has the molecular formula C27H17Li and a molecular weight of 348.37 g/mol. Its IUPAC name is lithium 1-cyclopenta-1,4-dien-1-ylpentaphene.
| Compound Name | lithium 1-cyclopenta-1,4-dien-1-ylpentaphene |
|---|---|
| PubChem CID | 175065646 |
| Molecular Formula | C27H17Li |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | lithium 1-cyclopenta-1,4-dien-1-ylpentaphene |
| SMILES | [C-]1=C(c2cccc3cc4ccc5cc6ccccc6cc5c4cc23)C=CC1.[Li+] |
| InChI | InChI=1S/C27H17.Li/c1-2-7-18(6-1)24-11-5-10-21-15-23-13-12-22-14-19-8-3-4-9-20(19)16-25(22)27(23)17-26(21)24;/h1,3-6,8-17H,2H2;/q-1;+1 |
| InChIKey | QSODAZSPDWWCOY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|