C22H22Pt — CID 22129003
carbanide;1-cyclopenta-1,4-dien-1-ylphenanthrene;platinum(4+) (PubChem CID 22129003) has the molecular formula C22H22Pt and a molecular weight of 481.50 g/mol. Its IUPAC name is carbanide;1-cyclopenta-1,4-dien-1-ylphenanthrene;platinum(4+).
| Compound Name | carbanide;1-cyclopenta-1,4-dien-1-ylphenanthrene;platinum(4+) |
|---|---|
| PubChem CID | 22129003 |
| Molecular Formula | C22H22Pt |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | carbanide;1-cyclopenta-1,4-dien-1-ylphenanthrene;platinum(4+) |
| SMILES | [C-]1=C(c2cccc3c2ccc2ccccc23)C=CC1.[CH3-].[CH3-].[CH3-].[Pt+4] |
| InChI | InChI=1S/C19H13.3CH3.Pt/c1-2-7-14(6-1)17-10-5-11-18-16-9-4-3-8-15(16)12-13-19(17)18;;;;/h1,3-6,8-13H,2H2;3*1H3;/q4*-1;+4 |
| InChIKey | JXJMTJYUBZGPTO-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|