C23H26N10O5 — CID 175071298
(2R,3R,4S,5R)-2-(6-amino-6-benzyl-8H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;2-amino-3H-pteridin-4-one (PubChem CID 175071298) has the molecular formula C23H26N10O5 and a molecular weight of 522.53 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-6-benzyl-8H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;2-amino-3H-pteridin-4-one.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-6-benzyl-8H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;2-amino-3H-pteridin-4-one |
|---|---|
| PubChem CID | 175071298 |
| Molecular Formula | C23H26N10O5 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-6-benzyl-8H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;2-amino-3H-pteridin-4-one |
| SMILES | NC1(Cc2ccccc2)N=CN=C2C1=NCN2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.Nc1nc2nccnc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H21N5O4.C6H5N5O/c18-17(6-10-4-2-1-3-5-10)14-15(19-8-21-17)22(9-20-14)16-13(25)12(24)11(7-23)26-16;7-6-10-4-3(5(12)11-6)8-1-2-9-4/h1-5,8,11-13,16,23-25H,6-7,9,18H2;1-2H,(H3,7,9,10,11,12)/t11-,12-,13-,16-,17?;/m1./s1 |
| InChIKey | RGXWHRZPWJVWJU-HQIWXJELSA-N |
| XLogP | -2.23 |
| TPSA | 233.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |