C20H22N6O4S — CID 150545063
(2R,3R,4S,5R)-2-[6-amino-6-[(4-phenyl-1,3-thiazol-2-yl)methyl]-8H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 150545063) has the molecular formula C20H22N6O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-6-[(4-phenyl-1,3-thiazol-2-yl)methyl]-8H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-6-[(4-phenyl-1,3-thiazol-2-yl)methyl]-8H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 150545063 |
| Molecular Formula | C20H22N6O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-6-[(4-phenyl-1,3-thiazol-2-yl)methyl]-8H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | NC1(Cc2nc(-c3ccccc3)cs2)N=CN=C2C1=NCN2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H22N6O4S/c21-20(6-14-25-12(8-31-14)11-4-2-1-3-5-11)17-18(22-9-24-20)26(10-23-17)19-16(29)15(28)13(7-27)30-19/h1-5,8-9,13,15-16,19,27-29H,6-7,10,21H2/t13-,15-,16-,19-,20?/m1/s1 |
| InChIKey | IGRORVIHFPQRTR-DBGWDLSPSA-N |
| XLogP | -0.40 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |