C13H10ClF3N4O7 — CID 175071831
6-chloro-8-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(2,2,2-trifluoroacetyl)pteridine-2,4-dione (PubChem CID 175071831) has the molecular formula C13H10ClF3N4O7 and a molecular weight of 426.69 g/mol. Its IUPAC name is 6-chloro-8-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(2,2,2-trifluoroacetyl)pteridine-2,4-dione.
| Compound Name | 6-chloro-8-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(2,2,2-trifluoroacetyl)pteridine-2,4-dione |
|---|---|
| PubChem CID | 175071831 |
| Molecular Formula | C13H10ClF3N4O7 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 6-chloro-8-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(2,2,2-trifluoroacetyl)pteridine-2,4-dione |
| SMILES | O=C(n1c(=O)nc2n([C@H]3O[C@H](CO)[C@@H](O)[C@H]3O)cc(Cl)nc-2c1=O)C(F)(F)F |
| InChI | InChI=1S/C13H10ClF3N4O7/c14-4-1-20(10-7(24)6(23)3(2-22)28-10)8-5(18-4)9(25)21(12(27)19-8)11(26)13(15,16)17/h1,3,6-7,10,22-24H,2H2/t3-,6-,7-,10+/m1/s1 |
| InChIKey | SPIILEOCQOIXJM-QQGNDTSESA-N |
| XLogP | -1.63 |
| TPSA | 156.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |