About sodium;arsane;hydrogen carbonate
sodium;arsane;hydrogen carbonate (PubChem CID 175072054) has the molecular formula CH4AsNaO3
and a molecular weight of 161.95 g/mol. Its IUPAC name is sodium;arsane;hydrogen carbonate.
Molecular Properties
| Compound Name | sodium;arsane;hydrogen carbonate |
| PubChem CID | 175072054 |
| Molecular Formula | CH4AsNaO3 |
| Molecular Weight | 161.95 g/mol |
| Exact Mass | 161.93 |
| IUPAC Name | sodium;arsane;hydrogen carbonate |
| SMILES | O=C([O-])O.[AsH3].[Na+] |
| InChI | InChI=1S/CH2O3.AsH3.Na/c2-1(3)4;;/h(H2,2,3,4);1H3;/q;;+1/p-1 |
| InChIKey | JREAWCULTKVPNQ-UHFFFAOYSA-M |
| XLogP | -5.29 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.95 |
| LogP ≤ 5 | -5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;arsane;hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;arsane;hydrogen carbonate?
The IUPAC name of sodium;arsane;hydrogen carbonate (CID 175072054) is sodium;arsane;hydrogen carbonate.
What is the SMILES notation for sodium;arsane;hydrogen carbonate?
The canonical SMILES for sodium;arsane;hydrogen carbonate is O=C([O-])O.[AsH3].[Na+].
What is the InChIKey of sodium;arsane;hydrogen carbonate?
The InChIKey is JREAWCULTKVPNQ-UHFFFAOYSA-M. The full InChI is InChI=1S/CH2O3.AsH3.Na/c2-1(3)4;;/h(H2,2,3,4);1H3;/q;;+1/p-1.
What are the key properties of sodium;arsane;hydrogen carbonate?
sodium;arsane;hydrogen carbonate has a molecular weight of 161.95 g/mol, XLogP of -5.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;arsane;hydrogen carbonate is sourced from PubChem (CID 175072054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).