C24H43N3O10 — CID 175073249
[1,5-bis[2-[butyl(carboxy)amino]ethoxy]-1,5-dioxopentan-2-yl]-butylcarbamic acid (PubChem CID 175073249) has the molecular formula C24H43N3O10 and a molecular weight of 533.62 g/mol. Its IUPAC name is [1,5-bis[2-[butyl(carboxy)amino]ethoxy]-1,5-dioxopentan-2-yl]-butylcarbamic acid.
| Compound Name | [1,5-bis[2-[butyl(carboxy)amino]ethoxy]-1,5-dioxopentan-2-yl]-butylcarbamic acid |
|---|---|
| PubChem CID | 175073249 |
| Molecular Formula | C24H43N3O10 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | [1,5-bis[2-[butyl(carboxy)amino]ethoxy]-1,5-dioxopentan-2-yl]-butylcarbamic acid |
| SMILES | CCCCN(CCOC(=O)CCC(C(=O)OCCN(CCCC)C(=O)O)N(CCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H43N3O10/c1-4-7-12-25(22(30)31)15-17-36-20(28)11-10-19(27(24(34)35)14-9-6-3)21(29)37-18-16-26(23(32)33)13-8-5-2/h19H,4-18H2,1-3H3,(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | FZRWYWPTEULHTO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 174.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |