C20H39N3O6 — CID 174982637
1,5-bis[butyl(carboxy)amino]pentan-3-yl-butylcarbamic acid (PubChem CID 174982637) has the molecular formula C20H39N3O6 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1,5-bis[butyl(carboxy)amino]pentan-3-yl-butylcarbamic acid.
| Compound Name | 1,5-bis[butyl(carboxy)amino]pentan-3-yl-butylcarbamic acid |
|---|---|
| PubChem CID | 174982637 |
| Molecular Formula | C20H39N3O6 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 1,5-bis[butyl(carboxy)amino]pentan-3-yl-butylcarbamic acid |
| SMILES | CCCCN(CCC(CCN(CCCC)C(=O)O)N(CCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H39N3O6/c1-4-7-12-21(18(24)25)15-10-17(23(20(28)29)14-9-6-3)11-16-22(19(26)27)13-8-5-2/h17H,4-16H2,1-3H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | RPWRRLDJAPVSCM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |