About cyclohexen-1-amine;triethoxy(propyl)silane
cyclohexen-1-amine;triethoxy(propyl)silane (PubChem CID 175073818) has the molecular formula C15H33NO3Si
and a molecular weight of 303.52 g/mol. Its IUPAC name is cyclohexen-1-amine;triethoxy(propyl)silane.
Molecular Properties
| Compound Name | cyclohexen-1-amine;triethoxy(propyl)silane |
| PubChem CID | 175073818 |
| Molecular Formula | C15H33NO3Si |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | cyclohexen-1-amine;triethoxy(propyl)silane |
| SMILES | CCC[Si](OCC)(OCC)OCC.NC1=CCCCC1 |
| InChI | InChI=1S/C9H22O3Si.C6H11N/c1-5-9-13(10-6-2,11-7-3)12-8-4;7-6-4-2-1-3-5-6/h5-9H2,1-4H3;4H,1-3,5,7H2 |
| InChIKey | UECVUPOTBUDZDG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclohexen-1-amine;triethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexen-1-amine;triethoxy(propyl)silane?
The IUPAC name of cyclohexen-1-amine;triethoxy(propyl)silane (CID 175073818) is cyclohexen-1-amine;triethoxy(propyl)silane.
What is the SMILES notation for cyclohexen-1-amine;triethoxy(propyl)silane?
The canonical SMILES for cyclohexen-1-amine;triethoxy(propyl)silane is CCC[Si](OCC)(OCC)OCC.NC1=CCCCC1.
What is the InChIKey of cyclohexen-1-amine;triethoxy(propyl)silane?
The InChIKey is UECVUPOTBUDZDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O3Si.C6H11N/c1-5-9-13(10-6-2,11-7-3)12-8-4;7-6-4-2-1-3-5-6/h5-9H2,1-4H3;4H,1-3,5,7H2.
What are the key properties of cyclohexen-1-amine;triethoxy(propyl)silane?
cyclohexen-1-amine;triethoxy(propyl)silane has a molecular weight of 303.52 g/mol, XLogP of 3.85, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexen-1-amine;triethoxy(propyl)silane is sourced from PubChem (CID 175073818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).