C23H21NO4S2 — CID 175074316
2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-3-sulfanyl-2,3-dihydroquinolin-4-one (PubChem CID 175074316) has the molecular formula C23H21NO4S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-3-sulfanyl-2,3-dihydroquinolin-4-one.
| Compound Name | 2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-3-sulfanyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 175074316 |
| Molecular Formula | C23H21NO4S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-3-sulfanyl-2,3-dihydroquinolin-4-one |
| SMILES | COc1ccc(C2C(S)C(=O)c3ccccc3N2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H21NO4S2/c1-15-7-13-18(14-8-15)30(26,27)24-20-6-4-3-5-19(20)22(25)23(29)21(24)16-9-11-17(28-2)12-10-16/h3-14,21,23,29H,1-2H3 |
| InChIKey | HCTWMLGMUWRZMH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|