About benzonitrile;4-bromo-3-iodoquinoline
benzonitrile;4-bromo-3-iodoquinoline (PubChem CID 175074751) has the molecular formula C16H10BrIN2
and a molecular weight of 437.08 g/mol. Its IUPAC name is benzonitrile;4-bromo-3-iodoquinoline.
Molecular Properties
| Compound Name | benzonitrile;4-bromo-3-iodoquinoline |
| PubChem CID | 175074751 |
| Molecular Formula | C16H10BrIN2 |
| Molecular Weight | 437.08 g/mol |
| Exact Mass | 435.91 |
| IUPAC Name | benzonitrile;4-bromo-3-iodoquinoline |
| SMILES | Brc1c(I)cnc2ccccc12.N#Cc1ccccc1 |
| InChI | InChI=1S/C9H5BrIN.C7H5N/c10-9-6-3-1-2-4-8(6)12-5-7(9)11;8-6-7-4-2-1-3-5-7/h1-5H;1-5H |
| InChIKey | KVALFCOFOZKKLR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.08 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze benzonitrile;4-bromo-3-iodoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzonitrile;4-bromo-3-iodoquinoline?
The IUPAC name of benzonitrile;4-bromo-3-iodoquinoline (CID 175074751) is benzonitrile;4-bromo-3-iodoquinoline.
What is the SMILES notation for benzonitrile;4-bromo-3-iodoquinoline?
The canonical SMILES for benzonitrile;4-bromo-3-iodoquinoline is Brc1c(I)cnc2ccccc12.N#Cc1ccccc1.
What is the InChIKey of benzonitrile;4-bromo-3-iodoquinoline?
The InChIKey is KVALFCOFOZKKLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrIN.C7H5N/c10-9-6-3-1-2-4-8(6)12-5-7(9)11;8-6-7-4-2-1-3-5-7/h1-5H;1-5H.
What are the key properties of benzonitrile;4-bromo-3-iodoquinoline?
benzonitrile;4-bromo-3-iodoquinoline has a molecular weight of 437.08 g/mol, XLogP of 5.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzonitrile;4-bromo-3-iodoquinoline is sourced from PubChem (CID 175074751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).