C16H30O3 — CID 175076065
acetic acid;tetradeca-1,9-dien-1-ol (PubChem CID 175076065) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is acetic acid;tetradeca-1,9-dien-1-ol.
| Compound Name | acetic acid;tetradeca-1,9-dien-1-ol |
|---|---|
| PubChem CID | 175076065 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | acetic acid;tetradeca-1,9-dien-1-ol |
| SMILES | CC(=O)O.CCCCC=CCCCCCCC=CO |
| InChI | InChI=1S/C14H26O.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15;1-2(3)4/h5-6,13-15H,2-4,7-12H2,1H3;1H3,(H,3,4) |
| InChIKey | UNVOLBPZCZOFBH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|