C15H18N4 — CID 175079285
N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine (PubChem CID 175079285) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine.
| Compound Name | N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 175079285 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine |
| SMILES | C=CN(CCCCc1ccccc1)c1ncncn1 |
| InChI | InChI=1S/C15H18N4/c1-2-19(15-17-12-16-13-18-15)11-7-6-10-14-8-4-3-5-9-14/h2-5,8-9,12-13H,1,6-7,10-11H2 |
| InChIKey | AGHLKLZXFGCGIH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|