About N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine
N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine (PubChem CID 175079285) has the molecular formula C15H18N4
and a molecular weight of 254.34 g/mol. Its IUPAC name is N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine |
| PubChem CID | 175079285 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine |
| SMILES | C=CN(CCCCc1ccccc1)c1ncncn1 |
| InChI | InChI=1S/C15H18N4/c1-2-19(15-17-12-16-13-18-15)11-7-6-10-14-8-4-3-5-9-14/h2-5,8-9,12-13H,1,6-7,10-11H2 |
| InChIKey | AGHLKLZXFGCGIH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine?
The IUPAC name of N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine (CID 175079285) is N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine.
What is the SMILES notation for N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine?
The canonical SMILES for N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine is C=CN(CCCCc1ccccc1)c1ncncn1.
What is the InChIKey of N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine?
The InChIKey is AGHLKLZXFGCGIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4/c1-2-19(15-17-12-16-13-18-15)11-7-6-10-14-8-4-3-5-9-14/h2-5,8-9,12-13H,1,6-7,10-11H2.
What are the key properties of N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine?
N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine has a molecular weight of 254.34 g/mol, XLogP of 2.84, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N-(4-phenylbutyl)-1,3,5-triazin-2-amine is sourced from PubChem (CID 175079285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).