C34H52N2O2Sn — CID 175081756
azane;[5,6-bis[(4-methoxyphenyl)methyl]-4-methyl-2-pyridinyl]-tributylstannane (PubChem CID 175081756) has the molecular formula C34H52N2O2Sn and a molecular weight of 639.51 g/mol. Its IUPAC name is azane;[5,6-bis[(4-methoxyphenyl)methyl]-4-methyl-2-pyridinyl]-tributylstannane.
| Compound Name | azane;[5,6-bis[(4-methoxyphenyl)methyl]-4-methyl-2-pyridinyl]-tributylstannane |
|---|---|
| PubChem CID | 175081756 |
| Molecular Formula | C34H52N2O2Sn |
| Molecular Weight | 639.51 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | azane;[5,6-bis[(4-methoxyphenyl)methyl]-4-methyl-2-pyridinyl]-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(C)c(Cc2ccc(OC)cc2)c(Cc2ccc(OC)cc2)n1.N |
| InChI | InChI=1S/C22H22NO2.3C4H9.H3N.Sn/c1-16-12-13-23-22(15-18-6-10-20(25-3)11-7-18)21(16)14-17-4-8-19(24-2)9-5-17;3*1-3-4-2;;/h4-12H,14-15H2,1-3H3;3*1,3-4H2,2H3;1H3; |
| InChIKey | BCARSSKJDNUFIF-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 66.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.51 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |