C27H38N2O2 — CID 175082055
2-(dimethylamino)-1-(2-morpholin-4-ylphenyl)-2-[(4-propan-2-ylphenyl)methyl]pentan-1-one (PubChem CID 175082055) has the molecular formula C27H38N2O2 and a molecular weight of 422.61 g/mol. Its IUPAC name is 2-(dimethylamino)-1-(2-morpholin-4-ylphenyl)-2-[(4-propan-2-ylphenyl)methyl]pentan-1-one.
| Compound Name | 2-(dimethylamino)-1-(2-morpholin-4-ylphenyl)-2-[(4-propan-2-ylphenyl)methyl]pentan-1-one |
|---|---|
| PubChem CID | 175082055 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 2-(dimethylamino)-1-(2-morpholin-4-ylphenyl)-2-[(4-propan-2-ylphenyl)methyl]pentan-1-one |
| SMILES | CCCC(Cc1ccc(C(C)C)cc1)(C(=O)c1ccccc1N1CCOCC1)N(C)C |
| InChI | InChI=1S/C27H38N2O2/c1-6-15-27(28(4)5,20-22-11-13-23(14-12-22)21(2)3)26(30)24-9-7-8-10-25(24)29-16-18-31-19-17-29/h7-14,21H,6,15-20H2,1-5H3 |
| InChIKey | NJKJCAMWUGJAIT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |