C24H35N3O2 — CID 175252354
2-benzyl-N,N-dimethyl-1-(2-morpholin-4-ylphenyl)butan-2-amine;formamide (PubChem CID 175252354) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 2-benzyl-N,N-dimethyl-1-(2-morpholin-4-ylphenyl)butan-2-amine;formamide.
| Compound Name | 2-benzyl-N,N-dimethyl-1-(2-morpholin-4-ylphenyl)butan-2-amine;formamide |
|---|---|
| PubChem CID | 175252354 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 2-benzyl-N,N-dimethyl-1-(2-morpholin-4-ylphenyl)butan-2-amine;formamide |
| SMILES | CCC(Cc1ccccc1)(Cc1ccccc1N1CCOCC1)N(C)C.NC=O |
| InChI | InChI=1S/C23H32N2O.CH3NO/c1-4-23(24(2)3,18-20-10-6-5-7-11-20)19-21-12-8-9-13-22(21)25-14-16-26-17-15-25;2-1-3/h5-13H,4,14-19H2,1-3H3;1H,(H2,2,3) |
| InChIKey | YQKWRHRTRQXVOR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|