C28H42N4O — CID 146184027
N,N-dimethyl-1-[4-(morpholin-4-ylmethyl)phenyl]-2-[(4-piperazin-1-ylphenyl)methyl]butan-2-amine (PubChem CID 146184027) has the molecular formula C28H42N4O and a molecular weight of 450.67 g/mol. Its IUPAC name is N,N-dimethyl-1-[4-(morpholin-4-ylmethyl)phenyl]-2-[(4-piperazin-1-ylphenyl)methyl]butan-2-amine.
| Compound Name | N,N-dimethyl-1-[4-(morpholin-4-ylmethyl)phenyl]-2-[(4-piperazin-1-ylphenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 146184027 |
| Molecular Formula | C28H42N4O |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.34 |
| IUPAC Name | N,N-dimethyl-1-[4-(morpholin-4-ylmethyl)phenyl]-2-[(4-piperazin-1-ylphenyl)methyl]butan-2-amine |
| SMILES | CCC(Cc1ccc(CN2CCOCC2)cc1)(Cc1ccc(N2CCNCC2)cc1)N(C)C |
| InChI | InChI=1S/C28H42N4O/c1-4-28(30(2)3,22-25-9-11-27(12-10-25)32-15-13-29-14-16-32)21-24-5-7-26(8-6-24)23-31-17-19-33-20-18-31/h5-12,29H,4,13-23H2,1-3H3 |
| InChIKey | TYTUSFNEUNJNPU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|