C22H16O4 — CID 175082888
(10-hydroxy-1-methyl-6-phenylphenanthren-9-yl) hydrogen carbonate (PubChem CID 175082888) has the molecular formula C22H16O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is (10-hydroxy-1-methyl-6-phenylphenanthren-9-yl) hydrogen carbonate.
| Compound Name | (10-hydroxy-1-methyl-6-phenylphenanthren-9-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 175082888 |
| Molecular Formula | C22H16O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (10-hydroxy-1-methyl-6-phenylphenanthren-9-yl) hydrogen carbonate |
| SMILES | Cc1cccc2c1c(O)c(OC(=O)O)c1ccc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C22H16O4/c1-13-6-5-9-16-18-12-15(14-7-3-2-4-8-14)10-11-17(18)21(26-22(24)25)20(23)19(13)16/h2-12,23H,1H3,(H,24,25) |
| InChIKey | VVGJHERZVWHJPK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|