C8H7F2N3 — CID 175083308
5,6-difluoro-N-methyl-1H-benzimidazol-2-amine (PubChem CID 175083308) has the molecular formula C8H7F2N3 and a molecular weight of 183.16 g/mol. Its IUPAC name is 5,6-difluoro-N-methyl-1H-benzimidazol-2-amine.
| Compound Name | 5,6-difluoro-N-methyl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 175083308 |
| Molecular Formula | C8H7F2N3 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 5,6-difluoro-N-methyl-1H-benzimidazol-2-amine |
| SMILES | CNc1nc2cc(F)c(F)cc2[nH]1 |
| InChI | InChI=1S/C8H7F2N3/c1-11-8-12-6-2-4(9)5(10)3-7(6)13-8/h2-3H,1H3,(H2,11,12,13) |
| InChIKey | XLKHVRYREDZHNQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |