C11H14N4O — CID 59522615
N,6-dimethyl-2-(methylamino)-1H-benzimidazole-5-carboxamide (PubChem CID 59522615) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is N,6-dimethyl-2-(methylamino)-1H-benzimidazole-5-carboxamide.
| Compound Name | N,6-dimethyl-2-(methylamino)-1H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 59522615 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | N,6-dimethyl-2-(methylamino)-1H-benzimidazole-5-carboxamide |
| SMILES | CNC(=O)c1cc2nc(NC)[nH]c2cc1C |
| InChI | InChI=1S/C11H14N4O/c1-6-4-8-9(15-11(13-3)14-8)5-7(6)10(16)12-2/h4-5H,1-3H3,(H,12,16)(H2,13,14,15) |
| InChIKey | YWUCWGLJOZDMTN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |