C7H3F2IN2S — CID 155081912
(5,6-difluoro-1H-benzimidazol-2-yl) thiohypoiodite (PubChem CID 155081912) has the molecular formula C7H3F2IN2S and a molecular weight of 312.08 g/mol. Its IUPAC name is (5,6-difluoro-1H-benzimidazol-2-yl) thiohypoiodite.
| Compound Name | (5,6-difluoro-1H-benzimidazol-2-yl) thiohypoiodite |
|---|---|
| PubChem CID | 155081912 |
| Molecular Formula | C7H3F2IN2S |
| Molecular Weight | 312.08 g/mol |
| Exact Mass | 311.90 |
| IUPAC Name | (5,6-difluoro-1H-benzimidazol-2-yl) thiohypoiodite |
| SMILES | Fc1cc2nc(SI)[nH]c2cc1F |
| InChI | InChI=1S/C7H3F2IN2S/c8-3-1-5-6(2-4(3)9)12-7(11-5)13-10/h1-2H,(H,11,12) |
| InChIKey | VPFWMWBBTHCXLK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.08 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|