C15H12F2N2O2S2 — CID 34382170
2-[2-(benzenesulfonyl)ethylsulfanyl]-5,6-difluoro-1H-benzimidazole (PubChem CID 34382170) has the molecular formula C15H12F2N2O2S2 and a molecular weight of 354.40 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethylsulfanyl]-5,6-difluoro-1H-benzimidazole.
| Compound Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-5,6-difluoro-1H-benzimidazole |
|---|---|
| PubChem CID | 34382170 |
| Molecular Formula | C15H12F2N2O2S2 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-5,6-difluoro-1H-benzimidazole |
| SMILES | O=S(=O)(CCSc1nc2cc(F)c(F)cc2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C15H12F2N2O2S2/c16-11-8-13-14(9-12(11)17)19-15(18-13)22-6-7-23(20,21)10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H,18,19) |
| InChIKey | CHZBJFQIMYOPLJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |