C10H7F2N3S — CID 33361420
3-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]propanenitrile (PubChem CID 33361420) has the molecular formula C10H7F2N3S and a molecular weight of 239.25 g/mol. Its IUPAC name is 3-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]propanenitrile.
| Compound Name | 3-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 33361420 |
| Molecular Formula | C10H7F2N3S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 3-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]propanenitrile |
| SMILES | N#CCCSc1nc2cc(F)c(F)cc2[nH]1 |
| InChI | InChI=1S/C10H7F2N3S/c11-6-4-8-9(5-7(6)12)15-10(14-8)16-3-1-2-13/h4-5H,1,3H2,(H,14,15) |
| InChIKey | SYCZQUQKRXSMIX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|